C9H15ClN2OS2 — CID 119405175
N-(3-aminopropyl)-3-methylsulfanylthiophene-2-carboxamide;hydrochloride (PubChem CID 119405175) has the molecular formula C9H15ClN2OS2 and a molecular weight of 266.82 g/mol. Its IUPAC name is N-(3-aminopropyl)-3-methylsulfanylthiophene-2-carboxamide;hydrochloride.
| Compound Name | N-(3-aminopropyl)-3-methylsulfanylthiophene-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119405175 |
| Molecular Formula | C9H15ClN2OS2 |
| Molecular Weight | 266.82 g/mol |
| Exact Mass | 266.03 |
| IUPAC Name | N-(3-aminopropyl)-3-methylsulfanylthiophene-2-carboxamide;hydrochloride |
| SMILES | CSc1ccsc1C(=O)NCCCN.Cl |
| InChI | InChI=1S/C9H14N2OS2.ClH/c1-13-7-3-6-14-8(7)9(12)11-5-2-4-10;/h3,6H,2,4-5,10H2,1H3,(H,11,12);1H |
| InChIKey | XPFGTXFBWVHWCQ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.82 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|