C15H27N3 — CID 11878704
(2R,7S,8R,14R)-1,3,13-triazatetracyclo[12.4.0.02,7.08,13]octadecane (PubChem CID 11878704) has the molecular formula C15H27N3 and a molecular weight of 249.40 g/mol. Its IUPAC name is (2R,7S,8R,14R)-1,3,13-triazatetracyclo[12.4.0.02,7.08,13]octadecane.
| Compound Name | (2R,7S,8R,14R)-1,3,13-triazatetracyclo[12.4.0.02,7.08,13]octadecane |
|---|---|
| PubChem CID | 11878704 |
| Molecular Formula | C15H27N3 |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.22 |
| IUPAC Name | (2R,7S,8R,14R)-1,3,13-triazatetracyclo[12.4.0.02,7.08,13]octadecane |
| SMILES | C1CN[C@H]2[C@@H](C1)[C@H]1CCCCN1[C@H]1CCCCN12 |
| InChI | InChI=1S/C15H27N3/c1-3-10-17-13(7-1)12-6-5-9-16-15(12)18-11-4-2-8-14(17)18/h12-16H,1-11H2/t12-,13+,14+,15+/m0/s1 |
| InChIKey | BJPDKJGEOOTNHF-GBJTYRQASA-N |
| XLogP | 1.99 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |