C18H34N2 — CID 167191312
10-methyl-2,10-diazatricyclo[9.8.0.02,9]nonadecane (PubChem CID 167191312) has the molecular formula C18H34N2 and a molecular weight of 278.48 g/mol. Its IUPAC name is 10-methyl-2,10-diazatricyclo[9.8.0.02,9]nonadecane.
| Compound Name | 10-methyl-2,10-diazatricyclo[9.8.0.02,9]nonadecane |
|---|---|
| PubChem CID | 167191312 |
| Molecular Formula | C18H34N2 |
| Molecular Weight | 278.48 g/mol |
| Exact Mass | 278.27 |
| IUPAC Name | 10-methyl-2,10-diazatricyclo[9.8.0.02,9]nonadecane |
| SMILES | CN1C2CCCCCCCCC2N2CCCCCCC12 |
| InChI | InChI=1S/C18H34N2/c1-19-16-12-8-4-2-3-5-9-13-17(16)20-15-11-7-6-10-14-18(19)20/h16-18H,2-15H2,1H3 |
| InChIKey | XXQIMSKHFREXAM-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.48 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |