C16H30N2 — CID 166733015
10-methyl-1,10-diazatricyclo[9.6.0.02,9]heptadecane (PubChem CID 166733015) has the molecular formula C16H30N2 and a molecular weight of 250.43 g/mol. Its IUPAC name is 10-methyl-1,10-diazatricyclo[9.6.0.02,9]heptadecane.
| Compound Name | 10-methyl-1,10-diazatricyclo[9.6.0.02,9]heptadecane |
|---|---|
| PubChem CID | 166733015 |
| Molecular Formula | C16H30N2 |
| Molecular Weight | 250.43 g/mol |
| Exact Mass | 250.24 |
| IUPAC Name | 10-methyl-1,10-diazatricyclo[9.6.0.02,9]heptadecane |
| SMILES | CN1C2CCCCCCC2N2CCCCCCC12 |
| InChI | InChI=1S/C16H30N2/c1-17-14-10-6-2-3-7-11-15(14)18-13-9-5-4-8-12-16(17)18/h14-16H,2-13H2,1H3 |
| InChIKey | UMKFBPOSIABPLS-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.43 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |