C19H27ClN2O3 — CID 118790457
2-(2-aminoethoxy)-5-chloro-N-(cyclobutylmethyl)-N-(oxolan-2-ylmethyl)benzamide (PubChem CID 118790457) has the molecular formula C19H27ClN2O3 and a molecular weight of 366.89 g/mol. Its IUPAC name is 2-(2-aminoethoxy)-5-chloro-N-(cyclobutylmethyl)-N-(oxolan-2-ylmethyl)benzamide.
| Compound Name | 2-(2-aminoethoxy)-5-chloro-N-(cyclobutylmethyl)-N-(oxolan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 118790457 |
| Molecular Formula | C19H27ClN2O3 |
| Molecular Weight | 366.89 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | 2-(2-aminoethoxy)-5-chloro-N-(cyclobutylmethyl)-N-(oxolan-2-ylmethyl)benzamide |
| SMILES | NCCOc1ccc(Cl)cc1C(=O)N(CC1CCC1)CC1CCCO1 |
| InChI | InChI=1S/C19H27ClN2O3/c20-15-6-7-18(25-10-8-21)17(11-15)19(23)22(12-14-3-1-4-14)13-16-5-2-9-24-16/h6-7,11,14,16H,1-5,8-10,12-13,21H2 |
| InChIKey | LQDYCQOFQIKJRO-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.89 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |