About 5-fluoro-N,N-dimethyl-2-[4-(trifluoromethyl)phenyl]aniline
5-fluoro-N,N-dimethyl-2-[4-(trifluoromethyl)phenyl]aniline (PubChem CID 118801806) has the molecular formula C15H13F4N
and a molecular weight of 283.27 g/mol. Its IUPAC name is 5-fluoro-N,N-dimethyl-2-[4-(trifluoromethyl)phenyl]aniline.
Molecular Properties
| Compound Name | 5-fluoro-N,N-dimethyl-2-[4-(trifluoromethyl)phenyl]aniline |
| PubChem CID | 118801806 |
| Molecular Formula | C15H13F4N |
| Molecular Weight | 283.27 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | 5-fluoro-N,N-dimethyl-2-[4-(trifluoromethyl)phenyl]aniline |
| SMILES | CN(C)c1cc(F)ccc1-c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H13F4N/c1-20(2)14-9-12(16)7-8-13(14)10-3-5-11(6-4-10)15(17,18)19/h3-9H,1-2H3 |
| InChIKey | XYLVYHMGJVWYHU-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.27 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-fluoro-N,N-dimethyl-2-[4-(trifluoromethyl)phenyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluoro-N,N-dimethyl-2-[4-(trifluoromethyl)phenyl]aniline?
The IUPAC name of 5-fluoro-N,N-dimethyl-2-[4-(trifluoromethyl)phenyl]aniline (CID 118801806) is 5-fluoro-N,N-dimethyl-2-[4-(trifluoromethyl)phenyl]aniline.
What is the SMILES notation for 5-fluoro-N,N-dimethyl-2-[4-(trifluoromethyl)phenyl]aniline?
The canonical SMILES for 5-fluoro-N,N-dimethyl-2-[4-(trifluoromethyl)phenyl]aniline is CN(C)c1cc(F)ccc1-c1ccc(C(F)(F)F)cc1.
What is the InChIKey of 5-fluoro-N,N-dimethyl-2-[4-(trifluoromethyl)phenyl]aniline?
The InChIKey is XYLVYHMGJVWYHU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13F4N/c1-20(2)14-9-12(16)7-8-13(14)10-3-5-11(6-4-10)15(17,18)19/h3-9H,1-2H3.
What are the key properties of 5-fluoro-N,N-dimethyl-2-[4-(trifluoromethyl)phenyl]aniline?
5-fluoro-N,N-dimethyl-2-[4-(trifluoromethyl)phenyl]aniline has a molecular weight of 283.27 g/mol, XLogP of 4.58, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluoro-N,N-dimethyl-2-[4-(trifluoromethyl)phenyl]aniline is sourced from PubChem (CID 118801806), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).