C16H26NO+ — CID 11880716
(1R,2R,10S,13S,15S)-15-methyl-6-azoniatetracyclo[8.6.0.01,6.02,13]hexadecan-11-one (PubChem CID 11880716) has the molecular formula C16H26NO+ and a molecular weight of 248.39 g/mol. Its IUPAC name is (1R,2R,10S,13S,15S)-15-methyl-6-azoniatetracyclo[8.6.0.01,6.02,13]hexadecan-11-one.
| Compound Name | (1R,2R,10S,13S,15S)-15-methyl-6-azoniatetracyclo[8.6.0.01,6.02,13]hexadecan-11-one |
|---|---|
| PubChem CID | 11880716 |
| Molecular Formula | C16H26NO+ |
| Molecular Weight | 248.39 g/mol |
| Exact Mass | 248.20 |
| IUPAC Name | (1R,2R,10S,13S,15S)-15-methyl-6-azoniatetracyclo[8.6.0.01,6.02,13]hexadecan-11-one |
| SMILES | C[C@H]1C[C@H]2CC(=O)[C@H]3CCC[NH+]4CCC[C@H]2[C@]34C1 |
| InChI | InChI=1S/C16H25NO/c1-11-8-12-9-15(18)14-5-3-7-17-6-2-4-13(12)16(14,17)10-11/h11-14H,2-10H2,1H3/p+1/t11-,12-,13+,14+,16+/m0/s1 |
| InChIKey | BCZFSDNVXODRAJ-ZHMBSYLPSA-O |
| XLogP | 1.45 |
| TPSA | 21.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.39 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |