C16H24NO+ — CID 11065883
(1R,2R,10S,13S,15R)-15-methyl-6-azoniatetracyclo[8.6.0.01,6.02,13]hexadec-5-en-11-one (PubChem CID 11065883) has the molecular formula C16H24NO+ and a molecular weight of 246.37 g/mol. Its IUPAC name is (1R,2R,10S,13S,15R)-15-methyl-6-azoniatetracyclo[8.6.0.01,6.02,13]hexadec-5-en-11-one.
| Compound Name | (1R,2R,10S,13S,15R)-15-methyl-6-azoniatetracyclo[8.6.0.01,6.02,13]hexadec-5-en-11-one |
|---|---|
| PubChem CID | 11065883 |
| Molecular Formula | C16H24NO+ |
| Molecular Weight | 246.37 g/mol |
| Exact Mass | 246.19 |
| IUPAC Name | (1R,2R,10S,13S,15R)-15-methyl-6-azoniatetracyclo[8.6.0.01,6.02,13]hexadec-5-en-11-one |
| SMILES | C[C@@H]1C[C@H]2CC(=O)[C@H]3CCC[N+]4=CCC[C@H]2[C@]34C1 |
| InChI | InChI=1S/C16H24NO/c1-11-8-12-9-15(18)14-5-3-7-17-6-2-4-13(12)16(14,17)10-11/h6,11-14H,2-5,7-10H2,1H3/q+1/t11-,12+,13-,14-,16-/m1/s1 |
| InChIKey | XHHBWADSISPGHY-JTTNIQEDSA-N |
| XLogP | 2.65 |
| TPSA | 20.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.37 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|