C17H26NO+ — CID 21457690
(1S,10S,13R,15R)-6,15-dimethyl-6-azoniatetracyclo[8.6.0.01,6.02,13]hexadec-2-en-11-one (PubChem CID 21457690) has the molecular formula C17H26NO+ and a molecular weight of 260.40 g/mol. Its IUPAC name is (1S,10S,13R,15R)-6,15-dimethyl-6-azoniatetracyclo[8.6.0.01,6.02,13]hexadec-2-en-11-one.
| Compound Name | (1S,10S,13R,15R)-6,15-dimethyl-6-azoniatetracyclo[8.6.0.01,6.02,13]hexadec-2-en-11-one |
|---|---|
| PubChem CID | 21457690 |
| Molecular Formula | C17H26NO+ |
| Molecular Weight | 260.40 g/mol |
| Exact Mass | 260.20 |
| IUPAC Name | (1S,10S,13R,15R)-6,15-dimethyl-6-azoniatetracyclo[8.6.0.01,6.02,13]hexadec-2-en-11-one |
| SMILES | C[C@@H]1C[C@@H]2CC(=O)[C@H]3CCC[N+]4(C)CCC=C2[C@]34C1 |
| InChI | InChI=1S/C17H26NO/c1-12-9-13-10-16(19)15-6-4-8-18(2)7-3-5-14(13)17(15,18)11-12/h5,12-13,15H,3-4,6-11H2,1-2H3/q+1/t12-,13-,15-,17-,18?/m1/s1 |
| InChIKey | XPJGEDBHPDSWRZ-WHFJOULGSA-N |
| XLogP | 2.93 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.40 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|