C6H6F2N2O3S — CID 118809083
6-(difluoromethyl)-5-hydroxypyridine-2-sulfonamide (PubChem CID 118809083) has the molecular formula C6H6F2N2O3S and a molecular weight of 224.19 g/mol. Its IUPAC name is 6-(difluoromethyl)-5-hydroxypyridine-2-sulfonamide.
| Compound Name | 6-(difluoromethyl)-5-hydroxypyridine-2-sulfonamide |
|---|---|
| PubChem CID | 118809083 |
| Molecular Formula | C6H6F2N2O3S |
| Molecular Weight | 224.19 g/mol |
| Exact Mass | 224.01 |
| IUPAC Name | 6-(difluoromethyl)-5-hydroxypyridine-2-sulfonamide |
| SMILES | NS(=O)(=O)c1ccc(O)c(C(F)F)n1 |
| InChI | InChI=1S/C6H6F2N2O3S/c7-6(8)5-3(11)1-2-4(10-5)14(9,12)13/h1-2,6,11H,(H2,9,12,13) |
| InChIKey | FPQSUTLTZFKLLZ-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 93.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.19 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |