C6H5ClF2N2O3S — CID 130072903
6-chloro-2-(difluoromethyl)-3-hydroxypyridine-4-sulfonamide (PubChem CID 130072903) has the molecular formula C6H5ClF2N2O3S and a molecular weight of 258.63 g/mol. Its IUPAC name is 6-chloro-2-(difluoromethyl)-3-hydroxypyridine-4-sulfonamide.
| Compound Name | 6-chloro-2-(difluoromethyl)-3-hydroxypyridine-4-sulfonamide |
|---|---|
| PubChem CID | 130072903 |
| Molecular Formula | C6H5ClF2N2O3S |
| Molecular Weight | 258.63 g/mol |
| Exact Mass | 257.97 |
| IUPAC Name | 6-chloro-2-(difluoromethyl)-3-hydroxypyridine-4-sulfonamide |
| SMILES | NS(=O)(=O)c1cc(Cl)nc(C(F)F)c1O |
| InChI | InChI=1S/C6H5ClF2N2O3S/c7-3-1-2(15(10,13)14)5(12)4(11-3)6(8)9/h1,6,12H,(H2,10,13,14) |
| InChIKey | CIXMLYHRPYEQOV-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 93.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.63 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|