C7H8F2N2O3S — CID 118826184
6-(difluoromethyl)-5-methoxypyridine-2-sulfonamide (PubChem CID 118826184) has the molecular formula C7H8F2N2O3S and a molecular weight of 238.21 g/mol. Its IUPAC name is 6-(difluoromethyl)-5-methoxypyridine-2-sulfonamide.
| Compound Name | 6-(difluoromethyl)-5-methoxypyridine-2-sulfonamide |
|---|---|
| PubChem CID | 118826184 |
| Molecular Formula | C7H8F2N2O3S |
| Molecular Weight | 238.21 g/mol |
| Exact Mass | 238.02 |
| IUPAC Name | 6-(difluoromethyl)-5-methoxypyridine-2-sulfonamide |
| SMILES | COc1ccc(S(N)(=O)=O)nc1C(F)F |
| InChI | InChI=1S/C7H8F2N2O3S/c1-14-4-2-3-5(15(10,12)13)11-6(4)7(8)9/h2-3,7H,1H3,(H2,10,12,13) |
| InChIKey | UJOJUGUIFCKEFV-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 82.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.21 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |