C9H6F5NO2 — CID 118823749
4-(difluoromethyl)-2-methyl-5-(trifluoromethoxy)pyridine-3-carbaldehyde (PubChem CID 118823749) has the molecular formula C9H6F5NO2 and a molecular weight of 255.14 g/mol. Its IUPAC name is 4-(difluoromethyl)-2-methyl-5-(trifluoromethoxy)pyridine-3-carbaldehyde.
| Compound Name | 4-(difluoromethyl)-2-methyl-5-(trifluoromethoxy)pyridine-3-carbaldehyde |
|---|---|
| PubChem CID | 118823749 |
| Molecular Formula | C9H6F5NO2 |
| Molecular Weight | 255.14 g/mol |
| Exact Mass | 255.03 |
| IUPAC Name | 4-(difluoromethyl)-2-methyl-5-(trifluoromethoxy)pyridine-3-carbaldehyde |
| SMILES | Cc1ncc(OC(F)(F)F)c(C(F)F)c1C=O |
| InChI | InChI=1S/C9H6F5NO2/c1-4-5(3-16)7(8(10)11)6(2-15-4)17-9(12,13)14/h2-3,8H,1H3 |
| InChIKey | AASXUDXZGMBBSW-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.14 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|