C8H6Cl2O4 — CID 118826485
2-(2,3-dichloro-4-hydroxyphenyl)-2-hydroxyacetic acid (PubChem CID 118826485) has the molecular formula C8H6Cl2O4 and a molecular weight of 237.04 g/mol. Its IUPAC name is 2-(2,3-dichloro-4-hydroxyphenyl)-2-hydroxyacetic acid.
| Compound Name | 2-(2,3-dichloro-4-hydroxyphenyl)-2-hydroxyacetic acid |
|---|---|
| PubChem CID | 118826485 |
| Molecular Formula | C8H6Cl2O4 |
| Molecular Weight | 237.04 g/mol |
| Exact Mass | 235.96 |
| IUPAC Name | 2-(2,3-dichloro-4-hydroxyphenyl)-2-hydroxyacetic acid |
| SMILES | O=C(O)C(O)c1ccc(O)c(Cl)c1Cl |
| InChI | InChI=1S/C8H6Cl2O4/c9-5-3(7(12)8(13)14)1-2-4(11)6(5)10/h1-2,7,11-12H,(H,13,14) |
| InChIKey | HALCRERWNPOHPX-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.04 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |