2-(2,3-dichloro-4-hydroxyphenyl)-2-hydroxyacetic acid

C8H6Cl2O4 — CID 118826485

IUPAC2-(2,3-dichloro-4-hydroxyphenyl)-2-hydroxyacetic acid
SMILESO=C(O)C(O)c1ccc(O)c(Cl)c1Cl
InChIInChI=1S/C8H6Cl2O4/c9-5-3(7(12)8(13)14)1-2-4(11)6(5)10/h1-2,7,11-12H,(H,13,14)
InChIKeyHALCRERWNPOHPX-UHFFFAOYSA-N
MW237.04 g/mol
LogP1.82
Rot. Bonds2

About 2-(2,3-dichloro-4-hydroxyphenyl)-2-hydroxyacetic acid

2-(2,3-dichloro-4-hydroxyphenyl)-2-hydroxyacetic acid (PubChem CID 118826485) has the molecular formula C8H6Cl2O4 and a molecular weight of 237.04 g/mol. Its IUPAC name is 2-(2,3-dichloro-4-hydroxyphenyl)-2-hydroxyacetic acid.

Molecular Properties

Compound Name2-(2,3-dichloro-4-hydroxyphenyl)-2-hydroxyacetic acid
PubChem CID118826485
Molecular FormulaC8H6Cl2O4
Molecular Weight237.04 g/mol
Exact Mass235.96
IUPAC Name2-(2,3-dichloro-4-hydroxyphenyl)-2-hydroxyacetic acid
SMILESO=C(O)C(O)c1ccc(O)c(Cl)c1Cl
InChIInChI=1S/C8H6Cl2O4/c9-5-3(7(12)8(13)14)1-2-4(11)6(5)10/h1-2,7,11-12H,(H,13,14)
InChIKeyHALCRERWNPOHPX-UHFFFAOYSA-N
XLogP1.82
TPSA77.76 Ų
H-Bond Donors3
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500237.04
LogP ≤ 51.82
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 103

Analyze 2-(2,3-dichloro-4-hydroxyphenyl)-2-hydroxyacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2,3-dichloro-4-hydroxyphenyl)-2-hydroxyacetic acid?
The IUPAC name of 2-(2,3-dichloro-4-hydroxyphenyl)-2-hydroxyacetic acid (CID 118826485) is 2-(2,3-dichloro-4-hydroxyphenyl)-2-hydroxyacetic acid.
What is the SMILES notation for 2-(2,3-dichloro-4-hydroxyphenyl)-2-hydroxyacetic acid?
The canonical SMILES for 2-(2,3-dichloro-4-hydroxyphenyl)-2-hydroxyacetic acid is O=C(O)C(O)c1ccc(O)c(Cl)c1Cl.
What is the InChIKey of 2-(2,3-dichloro-4-hydroxyphenyl)-2-hydroxyacetic acid?
The InChIKey is HALCRERWNPOHPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6Cl2O4/c9-5-3(7(12)8(13)14)1-2-4(11)6(5)10/h1-2,7,11-12H,(H,13,14).
What are the key properties of 2-(2,3-dichloro-4-hydroxyphenyl)-2-hydroxyacetic acid?
2-(2,3-dichloro-4-hydroxyphenyl)-2-hydroxyacetic acid has a molecular weight of 237.04 g/mol, XLogP of 1.82, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,3-dichloro-4-hydroxyphenyl)-2-hydroxyacetic acid is sourced from PubChem (CID 118826485), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).