About iPr2TpCu(CNAr)
iPr2TpCu(CNAr) (PubChem CID 118855578) has the molecular formula C36H55BCuN7+
and a molecular weight of 660.24 g/mol.
Molecular Properties
| Compound Name | iPr2TpCu(CNAr) |
| PubChem CID | 118855578 |
| Molecular Formula | C36H55BCuN7+ |
| Molecular Weight | 660.24 g/mol |
| Exact Mass | 659.39 |
| IUPAC Name | — |
| SMILES | C#[N+]c1c(C)cccc1C.CC(C)c1cc(C(C)C)n([B-](n2nc(C(C)C)cc2C(C)C)n2nc(C(C)C)cc2C(C)C)n1.[Cu+] |
| InChI | InChI=1S/C27H45BN6.C9H10N.Cu/c1-16(2)22-13-25(19(7)8)32(29-22)28(33-26(20(9)10)14-23(30-33)17(3)4)34-27(21(11)12)15-24(31-34)18(5)6;1-7-5-4-6-8(2)9(7)10-3;/h13-21H,1-12H3;3-6H,1-2H3;/q-1;2*+1 |
| InChIKey | NUQOBEPOEUISKP-UHFFFAOYSA-N |
| XLogP | 9.84 |
| TPSA | 57.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 660.24 |
| LogP ≤ 5 | 9.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze iPr2TpCu(CNAr) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iPr2TpCu(CNAr)?
The IUPAC name of iPr2TpCu(CNAr) (CID 118855578) is not available.
What is the SMILES notation for iPr2TpCu(CNAr)?
The canonical SMILES for iPr2TpCu(CNAr) is C#[N+]c1c(C)cccc1C.CC(C)c1cc(C(C)C)n([B-](n2nc(C(C)C)cc2C(C)C)n2nc(C(C)C)cc2C(C)C)n1.[Cu+].
What is the InChIKey of iPr2TpCu(CNAr)?
The InChIKey is NUQOBEPOEUISKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H45BN6.C9H10N.Cu/c1-16(2)22-13-25(19(7)8)32(29-22)28(33-26(20(9)10)14-23(30-33)17(3)4)34-27(21(11)12)15-24(31-34)18(5)6;1-7-5-4-6-8(2)9(7)10-3;/h13-21H,1-12H3;3-6H,1-2H3;/q-1;2*+1.
What are the key properties of iPr2TpCu(CNAr)?
iPr2TpCu(CNAr) has a molecular weight of 660.24 g/mol, XLogP of 9.84, 9 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for iPr2TpCu(CNAr) is sourced from PubChem (CID 118855578), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).