About thallium(1+);tris(3-benzyl-5-methylpyrazol-1-yl)boranuide
thallium(1+);tris(3-benzyl-5-methylpyrazol-1-yl)boranuide (PubChem CID 139131050) has the molecular formula C33H34BN6Tl
and a molecular weight of 729.87 g/mol. Its IUPAC name is thallium(1+);tris(3-benzyl-5-methylpyrazol-1-yl)boranuide.
Molecular Properties
| Compound Name | thallium(1+);tris(3-benzyl-5-methylpyrazol-1-yl)boranuide |
| PubChem CID | 139131050 |
| Molecular Formula | C33H34BN6Tl |
| Molecular Weight | 729.87 g/mol |
| Exact Mass | 730.27 |
| IUPAC Name | thallium(1+);tris(3-benzyl-5-methylpyrazol-1-yl)boranuide |
| SMILES | Cc1cc(Cc2ccccc2)nn1[BH-](n1nc(Cc2ccccc2)cc1C)n1nc(Cc2ccccc2)cc1C.[Tl+] |
| InChI | InChI=1S/C33H34BN6.Tl/c1-25-19-31(22-28-13-7-4-8-14-28)35-38(25)34(39-26(2)20-32(36-39)23-29-15-9-5-10-16-29)40-27(3)21-33(37-40)24-30-17-11-6-12-18-30;/h4-21,34H,22-24H2,1-3H3;/q-1;+1 |
| InChIKey | FFYPSYURSRXZBL-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 53.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 729.87 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze thallium(1+);tris(3-benzyl-5-methylpyrazol-1-yl)boranuide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of thallium(1+);tris(3-benzyl-5-methylpyrazol-1-yl)boranuide?
The IUPAC name of thallium(1+);tris(3-benzyl-5-methylpyrazol-1-yl)boranuide (CID 139131050) is thallium(1+);tris(3-benzyl-5-methylpyrazol-1-yl)boranuide.
What is the SMILES notation for thallium(1+);tris(3-benzyl-5-methylpyrazol-1-yl)boranuide?
The canonical SMILES for thallium(1+);tris(3-benzyl-5-methylpyrazol-1-yl)boranuide is Cc1cc(Cc2ccccc2)nn1[BH-](n1nc(Cc2ccccc2)cc1C)n1nc(Cc2ccccc2)cc1C.[Tl+].
What is the InChIKey of thallium(1+);tris(3-benzyl-5-methylpyrazol-1-yl)boranuide?
The InChIKey is FFYPSYURSRXZBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C33H34BN6.Tl/c1-25-19-31(22-28-13-7-4-8-14-28)35-38(25)34(39-26(2)20-32(36-39)23-29-15-9-5-10-16-29)40-27(3)21-33(37-40)24-30-17-11-6-12-18-30;/h4-21,34H,22-24H2,1-3H3;/q-1;+1.
What are the key properties of thallium(1+);tris(3-benzyl-5-methylpyrazol-1-yl)boranuide?
thallium(1+);tris(3-benzyl-5-methylpyrazol-1-yl)boranuide has a molecular weight of 729.87 g/mol, XLogP of 5.25, 9 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for thallium(1+);tris(3-benzyl-5-methylpyrazol-1-yl)boranuide is sourced from PubChem (CID 139131050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).