C10H19ClN2O4S3 — CID 118856664
(4S,6R)-4-(ethylamino)-6-methyl-7,7-dioxo-4,5,6,7a-tetrahydro-2H-thieno[2,3-b]thiopyran-2-sulfonamide;hydrochloride (PubChem CID 118856664) has the molecular formula C10H19ClN2O4S3 and a molecular weight of 362.93 g/mol. Its IUPAC name is (4S,6R)-4-(ethylamino)-6-methyl-7,7-dioxo-4,5,6,7a-tetrahydro-2H-thieno[2,3-b]thiopyran-2-sulfonamide;hydrochloride.
| Compound Name | (4S,6R)-4-(ethylamino)-6-methyl-7,7-dioxo-4,5,6,7a-tetrahydro-2H-thieno[2,3-b]thiopyran-2-sulfonamide;hydrochloride |
|---|---|
| PubChem CID | 118856664 |
| Molecular Formula | C10H19ClN2O4S3 |
| Molecular Weight | 362.93 g/mol |
| Exact Mass | 362.02 |
| IUPAC Name | (4S,6R)-4-(ethylamino)-6-methyl-7,7-dioxo-4,5,6,7a-tetrahydro-2H-thieno[2,3-b]thiopyran-2-sulfonamide;hydrochloride |
| SMILES | CCN[C@H]1C[C@@H](C)S(=O)(=O)C2SC(S(N)(=O)=O)C=C21.Cl |
| InChI | InChI=1S/C10H18N2O4S3.ClH/c1-3-12-8-4-6(2)18(13,14)10-7(8)5-9(17-10)19(11,15)16;/h5-6,8-10,12H,3-4H2,1-2H3,(H2,11,15,16);1H/t6-,8+,9?,10?;/m1./s1 |
| InChIKey | QGBNACCGSDCDNP-VBJZZQLHSA-N |
| XLogP | 0.21 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.93 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|