C14H13F3O8P2 — CID 118859907
[4-[4-[hydroxy(methoxy)phosphoryl]oxyphenoxy]phenoxy]-(trifluoromethyl)phosphinic acid (PubChem CID 118859907) has the molecular formula C14H13F3O8P2 and a molecular weight of 428.19 g/mol. Its IUPAC name is [4-[4-[hydroxy(methoxy)phosphoryl]oxyphenoxy]phenoxy]-(trifluoromethyl)phosphinic acid.
| Compound Name | [4-[4-[hydroxy(methoxy)phosphoryl]oxyphenoxy]phenoxy]-(trifluoromethyl)phosphinic acid |
|---|---|
| PubChem CID | 118859907 |
| Molecular Formula | C14H13F3O8P2 |
| Molecular Weight | 428.19 g/mol |
| Exact Mass | 428.00 |
| IUPAC Name | [4-[4-[hydroxy(methoxy)phosphoryl]oxyphenoxy]phenoxy]-(trifluoromethyl)phosphinic acid |
| SMILES | COP(=O)(O)Oc1ccc(Oc2ccc(OP(=O)(O)C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C14H13F3O8P2/c1-22-27(20,21)25-13-8-4-11(5-9-13)23-10-2-6-12(7-3-10)24-26(18,19)14(15,16)17/h2-9H,1H3,(H,18,19)(H,20,21) |
| InChIKey | VKUVPXQUXCVCCN-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.19 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|