C9H7BrF3N — CID 118862256
4-bromo-6-(trifluoromethyl)-2,3-dihydro-1H-indole (PubChem CID 118862256) has the molecular formula C9H7BrF3N and a molecular weight of 266.06 g/mol. Its IUPAC name is 4-bromo-6-(trifluoromethyl)-2,3-dihydro-1H-indole.
| Compound Name | 4-bromo-6-(trifluoromethyl)-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 118862256 |
| Molecular Formula | C9H7BrF3N |
| Molecular Weight | 266.06 g/mol |
| Exact Mass | 264.97 |
| IUPAC Name | 4-bromo-6-(trifluoromethyl)-2,3-dihydro-1H-indole |
| SMILES | FC(F)(F)c1cc(Br)c2c(c1)NCC2 |
| InChI | InChI=1S/C9H7BrF3N/c10-7-3-5(9(11,12)13)4-8-6(7)1-2-14-8/h3-4,14H,1-2H2 |
| InChIKey | FITCRRHDJKKTFY-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.06 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |