About 2-phenylethenesulfonate;tetraoctylazanium
2-phenylethenesulfonate;tetraoctylazanium (PubChem CID 118874939) has the molecular formula C40H75NO3S
and a molecular weight of 650.11 g/mol. Its IUPAC name is 2-phenylethenesulfonate;tetraoctylazanium.
Molecular Properties
| Compound Name | 2-phenylethenesulfonate;tetraoctylazanium |
| PubChem CID | 118874939 |
| Molecular Formula | C40H75NO3S |
| Molecular Weight | 650.11 g/mol |
| Exact Mass | 649.55 |
| IUPAC Name | 2-phenylethenesulfonate;tetraoctylazanium |
| SMILES | CCCCCCCC[N+](CCCCCCCC)(CCCCCCCC)CCCCCCCC.O=S(=O)([O-])C=Cc1ccccc1 |
| InChI | InChI=1S/C32H68N.C8H8O3S/c1-5-9-13-17-21-25-29-33(30-26-22-18-14-10-6-2,31-27-23-19-15-11-7-3)32-28-24-20-16-12-8-4;9-12(10,11)7-6-8-4-2-1-3-5-8/h5-32H2,1-4H3;1-7H,(H,9,10,11)/q+1;/p-1 |
| InChIKey | PJECCFDGXCWDFP-UHFFFAOYSA-M |
| XLogP | 12.45 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 45 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 650.11 |
| LogP ≤ 5 | 12.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-phenylethenesulfonate;tetraoctylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylethenesulfonate;tetraoctylazanium?
The IUPAC name of 2-phenylethenesulfonate;tetraoctylazanium (CID 118874939) is 2-phenylethenesulfonate;tetraoctylazanium.
What is the SMILES notation for 2-phenylethenesulfonate;tetraoctylazanium?
The canonical SMILES for 2-phenylethenesulfonate;tetraoctylazanium is CCCCCCCC[N+](CCCCCCCC)(CCCCCCCC)CCCCCCCC.O=S(=O)([O-])C=Cc1ccccc1.
What is the InChIKey of 2-phenylethenesulfonate;tetraoctylazanium?
The InChIKey is PJECCFDGXCWDFP-UHFFFAOYSA-M. The full InChI is InChI=1S/C32H68N.C8H8O3S/c1-5-9-13-17-21-25-29-33(30-26-22-18-14-10-6-2,31-27-23-19-15-11-7-3)32-28-24-20-16-12-8-4;9-12(10,11)7-6-8-4-2-1-3-5-8/h5-32H2,1-4H3;1-7H,(H,9,10,11)/q+1;/p-1.
What are the key properties of 2-phenylethenesulfonate;tetraoctylazanium?
2-phenylethenesulfonate;tetraoctylazanium has a molecular weight of 650.11 g/mol, XLogP of 12.45, 30 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylethenesulfonate;tetraoctylazanium is sourced from PubChem (CID 118874939), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).