C26H35N3O4 — CID 118874995
3-[1-methyl-5-(3-methylbutyl)-2,4-dioxo-6-(2-propan-2-ylphenyl)-7,8-dihydropyrido[3,4-d]pyrimidin-3-yl]propyl formate (PubChem CID 118874995) has the molecular formula C26H35N3O4 and a molecular weight of 453.58 g/mol. Its IUPAC name is 3-[1-methyl-5-(3-methylbutyl)-2,4-dioxo-6-(2-propan-2-ylphenyl)-7,8-dihydropyrido[3,4-d]pyrimidin-3-yl]propyl formate.
| Compound Name | 3-[1-methyl-5-(3-methylbutyl)-2,4-dioxo-6-(2-propan-2-ylphenyl)-7,8-dihydropyrido[3,4-d]pyrimidin-3-yl]propyl formate |
|---|---|
| PubChem CID | 118874995 |
| Molecular Formula | C26H35N3O4 |
| Molecular Weight | 453.58 g/mol |
| Exact Mass | 453.26 |
| IUPAC Name | 3-[1-methyl-5-(3-methylbutyl)-2,4-dioxo-6-(2-propan-2-ylphenyl)-7,8-dihydropyrido[3,4-d]pyrimidin-3-yl]propyl formate |
| SMILES | CC(C)CCC1=C(c2ccccc2C(C)C)NCc2c1c(=O)n(CCCOC=O)c(=O)n2C |
| InChI | InChI=1S/C26H35N3O4/c1-17(2)11-12-21-23-22(15-27-24(21)20-10-7-6-9-19(20)18(3)4)28(5)26(32)29(25(23)31)13-8-14-33-16-30/h6-7,9-10,16-18,27H,8,11-15H2,1-5H3 |
| InChIKey | DUGVVGBSNXYLRV-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 82.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.58 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|