C20H32FN3 — CID 118877757
3-[1-(cyclooctylmethyl)piperidin-4-yl]-5-fluorobenzene-1,2-diamine (PubChem CID 118877757) has the molecular formula C20H32FN3 and a molecular weight of 333.50 g/mol. Its IUPAC name is 3-[1-(cyclooctylmethyl)piperidin-4-yl]-5-fluorobenzene-1,2-diamine.
| Compound Name | 3-[1-(cyclooctylmethyl)piperidin-4-yl]-5-fluorobenzene-1,2-diamine |
|---|---|
| PubChem CID | 118877757 |
| Molecular Formula | C20H32FN3 |
| Molecular Weight | 333.50 g/mol |
| Exact Mass | 333.26 |
| IUPAC Name | 3-[1-(cyclooctylmethyl)piperidin-4-yl]-5-fluorobenzene-1,2-diamine |
| SMILES | Nc1cc(F)cc(C2CCN(CC3CCCCCCC3)CC2)c1N |
| InChI | InChI=1S/C20H32FN3/c21-17-12-18(20(23)19(22)13-17)16-8-10-24(11-9-16)14-15-6-4-2-1-3-5-7-15/h12-13,15-16H,1-11,14,22-23H2 |
| InChIKey | XBQIDFSVTGPXBA-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.50 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|