C21H30ClFN2O — CID 141447139
1-(4-amino-5-chloro-2-fluorophenyl)-3-[1-(cyclohexylmethyl)piperidin-4-yl]propan-1-one (PubChem CID 141447139) has the molecular formula C21H30ClFN2O and a molecular weight of 380.94 g/mol. Its IUPAC name is 1-(4-amino-5-chloro-2-fluorophenyl)-3-[1-(cyclohexylmethyl)piperidin-4-yl]propan-1-one.
| Compound Name | 1-(4-amino-5-chloro-2-fluorophenyl)-3-[1-(cyclohexylmethyl)piperidin-4-yl]propan-1-one |
|---|---|
| PubChem CID | 141447139 |
| Molecular Formula | C21H30ClFN2O |
| Molecular Weight | 380.94 g/mol |
| Exact Mass | 380.20 |
| IUPAC Name | 1-(4-amino-5-chloro-2-fluorophenyl)-3-[1-(cyclohexylmethyl)piperidin-4-yl]propan-1-one |
| SMILES | Nc1cc(F)c(C(=O)CCC2CCN(CC3CCCCC3)CC2)cc1Cl |
| InChI | InChI=1S/C21H30ClFN2O/c22-18-12-17(19(23)13-20(18)24)21(26)7-6-15-8-10-25(11-9-15)14-16-4-2-1-3-5-16/h12-13,15-16H,1-11,14,24H2 |
| InChIKey | SKRHLMWNDMUQPR-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.94 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|