C25H39O9P — CID 118880844
benzyl (2S,3R)-4-[bis(2,2-dimethylpropanoyloxymethoxy)phosphoryl]-2,3-dimethylbutanoate (PubChem CID 118880844) has the molecular formula C25H39O9P and a molecular weight of 514.55 g/mol. Its IUPAC name is benzyl (2S,3R)-4-[bis(2,2-dimethylpropanoyloxymethoxy)phosphoryl]-2,3-dimethylbutanoate.
| Compound Name | benzyl (2S,3R)-4-[bis(2,2-dimethylpropanoyloxymethoxy)phosphoryl]-2,3-dimethylbutanoate |
|---|---|
| PubChem CID | 118880844 |
| Molecular Formula | C25H39O9P |
| Molecular Weight | 514.55 g/mol |
| Exact Mass | 514.23 |
| IUPAC Name | benzyl (2S,3R)-4-[bis(2,2-dimethylpropanoyloxymethoxy)phosphoryl]-2,3-dimethylbutanoate |
| SMILES | C[C@H](C(=O)OCc1ccccc1)[C@@H](C)CP(=O)(OCOC(=O)C(C)(C)C)OCOC(=O)C(C)(C)C |
| InChI | InChI=1S/C25H39O9P/c1-18(19(2)21(26)30-14-20-12-10-9-11-13-20)15-35(29,33-16-31-22(27)24(3,4)5)34-17-32-23(28)25(6,7)8/h9-13,18-19H,14-17H2,1-8H3/t18-,19-/m0/s1 |
| InChIKey | DWJPVLBBLUJDLK-OALUTQOASA-N |
| XLogP | 5.32 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.55 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|