C40H53O11P — CID 138111481
[2,2-dimethylpropanoyloxymethoxy-[[6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]methyl]phosphoryl]oxymethyl 2,2-dimethylpropanoate (PubChem CID 138111481) has the molecular formula C40H53O11P and a molecular weight of 740.83 g/mol. Its IUPAC name is [2,2-dimethylpropanoyloxymethoxy-[[6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]methyl]phosphoryl]oxymethyl 2,2-dimethylpropanoate.
| Compound Name | [2,2-dimethylpropanoyloxymethoxy-[[6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]methyl]phosphoryl]oxymethyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 138111481 |
| Molecular Formula | C40H53O11P |
| Molecular Weight | 740.83 g/mol |
| Exact Mass | 740.33 |
| IUPAC Name | [2,2-dimethylpropanoyloxymethoxy-[[6-methyl-3,4,5-tris(phenylmethoxy)oxan-2-yl]methyl]phosphoryl]oxymethyl 2,2-dimethylpropanoate |
| SMILES | CC1OC(CP(=O)(OCOC(=O)C(C)(C)C)OCOC(=O)C(C)(C)C)C(OCc2ccccc2)C(OCc2ccccc2)C1OCc1ccccc1 |
| InChI | InChI=1S/C40H53O11P/c1-29-34(44-23-30-17-11-8-12-18-30)36(46-25-32-21-15-10-16-22-32)35(45-24-31-19-13-9-14-20-31)33(51-29)26-52(43,49-27-47-37(41)39(2,3)4)50-28-48-38(42)40(5,6)7/h8-22,29,33-36H,23-28H2,1-7H3 |
| InChIKey | UDKWNFSMIRGOHM-UHFFFAOYSA-N |
| XLogP | 7.85 |
| TPSA | 125.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 52 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 740.83 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|