C24H41O12P — CID 118603469
[[(2R,3S,4R,5R,6S)-3,4-diacetyloxy-5,6-dimethyloxan-2-yl]methyl-(2,2-dimethylpropanoyloxymethoxy)phosphoryl]oxymethyl 2,2-dimethylpropanoate (PubChem CID 118603469) has the molecular formula C24H41O12P and a molecular weight of 552.55 g/mol. Its IUPAC name is [[(2R,3S,4R,5R,6S)-3,4-diacetyloxy-5,6-dimethyloxan-2-yl]methyl-(2,2-dimethylpropanoyloxymethoxy)phosphoryl]oxymethyl 2,2-dimethylpropanoate.
| Compound Name | [[(2R,3S,4R,5R,6S)-3,4-diacetyloxy-5,6-dimethyloxan-2-yl]methyl-(2,2-dimethylpropanoyloxymethoxy)phosphoryl]oxymethyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 118603469 |
| Molecular Formula | C24H41O12P |
| Molecular Weight | 552.55 g/mol |
| Exact Mass | 552.23 |
| IUPAC Name | [[(2R,3S,4R,5R,6S)-3,4-diacetyloxy-5,6-dimethyloxan-2-yl]methyl-(2,2-dimethylpropanoyloxymethoxy)phosphoryl]oxymethyl 2,2-dimethylpropanoate |
| SMILES | CC(=O)O[C@@H]1[C@H](C)[C@H](C)O[C@@H](CP(=O)(OCOC(=O)C(C)(C)C)OCOC(=O)C(C)(C)C)[C@H]1OC(C)=O |
| InChI | InChI=1S/C24H41O12P/c1-14-15(2)34-18(20(36-17(4)26)19(14)35-16(3)25)11-37(29,32-12-30-21(27)23(5,6)7)33-13-31-22(28)24(8,9)10/h14-15,18-20H,11-13H2,1-10H3/t14-,15+,18+,19-,20-/m1/s1 |
| InChIKey | GXRDCGVICXLTEH-GOKSDJKOSA-N |
| XLogP | 3.59 |
| TPSA | 149.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.55 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|