C13H26N2O3 — CID 118882677
(3S,4R)-N',N'-diethyl-3-hydroxy-4-methyloctanediamide (PubChem CID 118882677) has the molecular formula C13H26N2O3 and a molecular weight of 258.36 g/mol. Its IUPAC name is (3S,4R)-N',N'-diethyl-3-hydroxy-4-methyloctanediamide.
| Compound Name | (3S,4R)-N',N'-diethyl-3-hydroxy-4-methyloctanediamide |
|---|---|
| PubChem CID | 118882677 |
| Molecular Formula | C13H26N2O3 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.19 |
| IUPAC Name | (3S,4R)-N',N'-diethyl-3-hydroxy-4-methyloctanediamide |
| SMILES | CCN(CC)C(=O)CCC[C@@H](C)[C@@H](O)CC(N)=O |
| InChI | InChI=1S/C13H26N2O3/c1-4-15(5-2)13(18)8-6-7-10(3)11(16)9-12(14)17/h10-11,16H,4-9H2,1-3H3,(H2,14,17)/t10-,11+/m1/s1 |
| InChIKey | QCKVNKMZALYFNM-MNOVXSKESA-N |
| XLogP | 0.90 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |