C20H25NO8 — CID 118885779
4-(2-carboxyethyl)-4-[(4-oxo-4-phenylbutanoyl)amino]heptanedioic acid (PubChem CID 118885779) has the molecular formula C20H25NO8 and a molecular weight of 407.42 g/mol. Its IUPAC name is 4-(2-carboxyethyl)-4-[(4-oxo-4-phenylbutanoyl)amino]heptanedioic acid.
| Compound Name | 4-(2-carboxyethyl)-4-[(4-oxo-4-phenylbutanoyl)amino]heptanedioic acid |
|---|---|
| PubChem CID | 118885779 |
| Molecular Formula | C20H25NO8 |
| Molecular Weight | 407.42 g/mol |
| Exact Mass | 407.16 |
| IUPAC Name | 4-(2-carboxyethyl)-4-[(4-oxo-4-phenylbutanoyl)amino]heptanedioic acid |
| SMILES | O=C(O)CCC(CCC(=O)O)(CCC(=O)O)NC(=O)CCC(=O)c1ccccc1 |
| InChI | InChI=1S/C20H25NO8/c22-15(14-4-2-1-3-5-14)6-7-16(23)21-20(11-8-17(24)25,12-9-18(26)27)13-10-19(28)29/h1-5H,6-13H2,(H,21,23)(H,24,25)(H,26,27)(H,28,29) |
| InChIKey | GWWVHBXAJSCAMQ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 158.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.42 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |