C47H54N2O2 — CID 118892374
4-[3,6-bis[4-(2-ethylhexoxy)phenyl]-1,2-dihydrocarbazol-9-yl]benzonitrile (PubChem CID 118892374) has the molecular formula C47H54N2O2 and a molecular weight of 678.96 g/mol. Its IUPAC name is 4-[3,6-bis[4-(2-ethylhexoxy)phenyl]-1,2-dihydrocarbazol-9-yl]benzonitrile.
| Compound Name | 4-[3,6-bis[4-(2-ethylhexoxy)phenyl]-1,2-dihydrocarbazol-9-yl]benzonitrile |
|---|---|
| PubChem CID | 118892374 |
| Molecular Formula | C47H54N2O2 |
| Molecular Weight | 678.96 g/mol |
| Exact Mass | 678.42 |
| IUPAC Name | 4-[3,6-bis[4-(2-ethylhexoxy)phenyl]-1,2-dihydrocarbazol-9-yl]benzonitrile |
| SMILES | CCCCC(CC)COc1ccc(C2=Cc3c(n(-c4ccc(C#N)cc4)c4ccc(-c5ccc(OCC(CC)CCCC)cc5)cc34)CC2)cc1 |
| InChI | InChI=1S/C47H54N2O2/c1-5-9-11-34(7-3)32-50-42-23-15-37(16-24-42)39-19-27-46-44(29-39)45-30-40(20-28-47(45)49(46)41-21-13-36(31-48)14-22-41)38-17-25-43(26-18-38)51-33-35(8-4)12-10-6-2/h13-19,21-27,29-30,34-35H,5-12,20,28,32-33H2,1-4H3 |
| InChIKey | MOZMINQEXZMUQA-UHFFFAOYSA-N |
| XLogP | 12.85 |
| TPSA | 47.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.96 |
| LogP ≤ 5 | 12.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |