C19H20N2O4 — CID 118894327
2-[(4-butyl-3-carbamoylphenyl)carbamoyl]benzoic acid (PubChem CID 118894327) has the molecular formula C19H20N2O4 and a molecular weight of 340.38 g/mol. Its IUPAC name is 2-[(4-butyl-3-carbamoylphenyl)carbamoyl]benzoic acid.
| Compound Name | 2-[(4-butyl-3-carbamoylphenyl)carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 118894327 |
| Molecular Formula | C19H20N2O4 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | 2-[(4-butyl-3-carbamoylphenyl)carbamoyl]benzoic acid |
| SMILES | CCCCc1ccc(NC(=O)c2ccccc2C(=O)O)cc1C(N)=O |
| InChI | InChI=1S/C19H20N2O4/c1-2-3-6-12-9-10-13(11-16(12)17(20)22)21-18(23)14-7-4-5-8-15(14)19(24)25/h4-5,7-11H,2-3,6H2,1H3,(H2,20,22)(H,21,23)(H,24,25) |
| InChIKey | GKSKQNGGSYUDGW-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |