C30H34N2O6 — CID 118894968
1-[2-[2,5-dioxo-3-(2-phenylethoxy)pyrrolidin-1-yl]cyclohexyl]-3-(phenylmethoxymethyl)pyrrolidine-2,5-dione (PubChem CID 118894968) has the molecular formula C30H34N2O6 and a molecular weight of 518.61 g/mol. Its IUPAC name is 1-[2-[2,5-dioxo-3-(2-phenylethoxy)pyrrolidin-1-yl]cyclohexyl]-3-(phenylmethoxymethyl)pyrrolidine-2,5-dione.
| Compound Name | 1-[2-[2,5-dioxo-3-(2-phenylethoxy)pyrrolidin-1-yl]cyclohexyl]-3-(phenylmethoxymethyl)pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 118894968 |
| Molecular Formula | C30H34N2O6 |
| Molecular Weight | 518.61 g/mol |
| Exact Mass | 518.24 |
| IUPAC Name | 1-[2-[2,5-dioxo-3-(2-phenylethoxy)pyrrolidin-1-yl]cyclohexyl]-3-(phenylmethoxymethyl)pyrrolidine-2,5-dione |
| SMILES | O=C1CC(COCc2ccccc2)C(=O)N1C1CCCCC1N1C(=O)CC(OCCc2ccccc2)C1=O |
| InChI | InChI=1S/C30H34N2O6/c33-27-17-23(20-37-19-22-11-5-2-6-12-22)29(35)31(27)24-13-7-8-14-25(24)32-28(34)18-26(30(32)36)38-16-15-21-9-3-1-4-10-21/h1-6,9-12,23-26H,7-8,13-20H2 |
| InChIKey | XUDLIJDSPASMGQ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.61 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|