C18H23NO4 — CID 118531814
(3S)-3-hydroxy-1-[(1R,2S)-2-(2-phenylethoxy)cyclohexyl]pyrrolidine-2,5-dione (PubChem CID 118531814) has the molecular formula C18H23NO4 and a molecular weight of 317.38 g/mol. Its IUPAC name is (3S)-3-hydroxy-1-[(1R,2S)-2-(2-phenylethoxy)cyclohexyl]pyrrolidine-2,5-dione.
| Compound Name | (3S)-3-hydroxy-1-[(1R,2S)-2-(2-phenylethoxy)cyclohexyl]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 118531814 |
| Molecular Formula | C18H23NO4 |
| Molecular Weight | 317.38 g/mol |
| Exact Mass | 317.16 |
| IUPAC Name | (3S)-3-hydroxy-1-[(1R,2S)-2-(2-phenylethoxy)cyclohexyl]pyrrolidine-2,5-dione |
| SMILES | O=C1C[C@H](O)C(=O)N1[C@@H]1CCCC[C@@H]1OCCc1ccccc1 |
| InChI | InChI=1S/C18H23NO4/c20-15-12-17(21)19(18(15)22)14-8-4-5-9-16(14)23-11-10-13-6-2-1-3-7-13/h1-3,6-7,14-16,20H,4-5,8-12H2/t14-,15+,16+/m1/s1 |
| InChIKey | BERIVMDGUMPRJQ-PMPSAXMXSA-N |
| XLogP | 1.68 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.38 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|