C22H29NO6 — CID 70642133
[(3R)-1-[(1R,2R)-2-[2-(4-methoxy-3-methylphenyl)ethoxy]cyclohexyl]-2,5-dioxopyrrolidin-3-yl] acetate (PubChem CID 70642133) has the molecular formula C22H29NO6 and a molecular weight of 403.48 g/mol. Its IUPAC name is [(3R)-1-[(1R,2R)-2-[2-(4-methoxy-3-methylphenyl)ethoxy]cyclohexyl]-2,5-dioxopyrrolidin-3-yl] acetate.
| Compound Name | [(3R)-1-[(1R,2R)-2-[2-(4-methoxy-3-methylphenyl)ethoxy]cyclohexyl]-2,5-dioxopyrrolidin-3-yl] acetate |
|---|---|
| PubChem CID | 70642133 |
| Molecular Formula | C22H29NO6 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | [(3R)-1-[(1R,2R)-2-[2-(4-methoxy-3-methylphenyl)ethoxy]cyclohexyl]-2,5-dioxopyrrolidin-3-yl] acetate |
| SMILES | COc1ccc(CCO[C@@H]2CCCC[C@H]2N2C(=O)C[C@@H](OC(C)=O)C2=O)cc1C |
| InChI | InChI=1S/C22H29NO6/c1-14-12-16(8-9-18(14)27-3)10-11-28-19-7-5-4-6-17(19)23-21(25)13-20(22(23)26)29-15(2)24/h8-9,12,17,19-20H,4-7,10-11,13H2,1-3H3/t17-,19-,20-/m1/s1 |
| InChIKey | TWQZSFPBPOYQDO-MISYRCLQSA-N |
| XLogP | 2.56 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|