C12H14O7 — CID 118899808
2-[[5-(carboxymethyl)furan-2-yl]methyl]pentanedioic acid (PubChem CID 118899808) has the molecular formula C12H14O7 and a molecular weight of 270.24 g/mol. Its IUPAC name is 2-[[5-(carboxymethyl)furan-2-yl]methyl]pentanedioic acid.
| Compound Name | 2-[[5-(carboxymethyl)furan-2-yl]methyl]pentanedioic acid |
|---|---|
| PubChem CID | 118899808 |
| Molecular Formula | C12H14O7 |
| Molecular Weight | 270.24 g/mol |
| Exact Mass | 270.07 |
| IUPAC Name | 2-[[5-(carboxymethyl)furan-2-yl]methyl]pentanedioic acid |
| SMILES | O=C(O)CCC(Cc1ccc(CC(=O)O)o1)C(=O)O |
| InChI | InChI=1S/C12H14O7/c13-10(14)4-1-7(12(17)18)5-8-2-3-9(19-8)6-11(15)16/h2-3,7H,1,4-6H2,(H,13,14)(H,15,16)(H,17,18) |
| InChIKey | PMPDTSLATNJWTE-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.24 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |