C9H12BrNO3 — CID 62961515
4-amino-5-(5-bromofuran-2-yl)pentanoic acid (PubChem CID 62961515) has the molecular formula C9H12BrNO3 and a molecular weight of 262.10 g/mol. Its IUPAC name is 4-amino-5-(5-bromofuran-2-yl)pentanoic acid.
| Compound Name | 4-amino-5-(5-bromofuran-2-yl)pentanoic acid |
|---|---|
| PubChem CID | 62961515 |
| Molecular Formula | C9H12BrNO3 |
| Molecular Weight | 262.10 g/mol |
| Exact Mass | 261.00 |
| IUPAC Name | 4-amino-5-(5-bromofuran-2-yl)pentanoic acid |
| SMILES | NC(CCC(=O)O)Cc1ccc(Br)o1 |
| InChI | InChI=1S/C9H12BrNO3/c10-8-3-2-7(14-8)5-6(11)1-4-9(12)13/h2-3,6H,1,4-5,11H2,(H,12,13) |
| InChIKey | MYVLTJMLOTWMIQ-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.10 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |