C16H20O9 — CID 118899413
2-[2-[5-(3,4-dicarboxybutyl)furan-2-yl]ethyl]butanedioic acid (PubChem CID 118899413) has the molecular formula C16H20O9 and a molecular weight of 356.33 g/mol. Its IUPAC name is 2-[2-[5-(3,4-dicarboxybutyl)furan-2-yl]ethyl]butanedioic acid.
| Compound Name | 2-[2-[5-(3,4-dicarboxybutyl)furan-2-yl]ethyl]butanedioic acid |
|---|---|
| PubChem CID | 118899413 |
| Molecular Formula | C16H20O9 |
| Molecular Weight | 356.33 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | 2-[2-[5-(3,4-dicarboxybutyl)furan-2-yl]ethyl]butanedioic acid |
| SMILES | O=C(O)CC(CCc1ccc(CCC(CC(=O)O)C(=O)O)o1)C(=O)O |
| InChI | InChI=1S/C16H20O9/c17-13(18)7-9(15(21)22)1-3-11-5-6-12(25-11)4-2-10(16(23)24)8-14(19)20/h5-6,9-10H,1-4,7-8H2,(H,17,18)(H,19,20)(H,21,22)(H,23,24) |
| InChIKey | FDLHEKZIRVSCII-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 162.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.33 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |