C30H23F9O — CID 118900742
6-[4-[difluoro-(1,7,8-trifluoro-6-propylnaphthalen-2-yl)methoxy]cyclohexyl]-1,2,3,8-tetrafluoronaphthalene (PubChem CID 118900742) has the molecular formula C30H23F9O and a molecular weight of 570.50 g/mol. Its IUPAC name is 6-[4-[difluoro-(1,7,8-trifluoro-6-propylnaphthalen-2-yl)methoxy]cyclohexyl]-1,2,3,8-tetrafluoronaphthalene.
| Compound Name | 6-[4-[difluoro-(1,7,8-trifluoro-6-propylnaphthalen-2-yl)methoxy]cyclohexyl]-1,2,3,8-tetrafluoronaphthalene |
|---|---|
| PubChem CID | 118900742 |
| Molecular Formula | C30H23F9O |
| Molecular Weight | 570.50 g/mol |
| Exact Mass | 570.16 |
| IUPAC Name | 6-[4-[difluoro-(1,7,8-trifluoro-6-propylnaphthalen-2-yl)methoxy]cyclohexyl]-1,2,3,8-tetrafluoronaphthalene |
| SMILES | CCCc1cc2ccc(C(F)(F)OC3CCC(c4cc(F)c5c(F)c(F)c(F)cc5c4)CC3)c(F)c2c(F)c1F |
| InChI | InChI=1S/C30H23F9O/c1-2-3-16-10-15-6-9-20(26(34)24(15)29(37)25(16)33)30(38,39)40-19-7-4-14(5-8-19)17-11-18-13-22(32)27(35)28(36)23(18)21(31)12-17/h6,9-14,19H,2-5,7-8H2,1H3 |
| InChIKey | KOGIRBGTIZVTBB-UHFFFAOYSA-N |
| XLogP | 9.71 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.50 |
| LogP ≤ 5 | 9.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|