C19H17NO2S — CID 118902133
2-[1-[[2-(4-cyanophenyl)phenyl]sulfanylmethyl]cyclopropyl]acetic acid (PubChem CID 118902133) has the molecular formula C19H17NO2S and a molecular weight of 323.42 g/mol. Its IUPAC name is 2-[1-[[2-(4-cyanophenyl)phenyl]sulfanylmethyl]cyclopropyl]acetic acid.
| Compound Name | 2-[1-[[2-(4-cyanophenyl)phenyl]sulfanylmethyl]cyclopropyl]acetic acid |
|---|---|
| PubChem CID | 118902133 |
| Molecular Formula | C19H17NO2S |
| Molecular Weight | 323.42 g/mol |
| Exact Mass | 323.10 |
| IUPAC Name | 2-[1-[[2-(4-cyanophenyl)phenyl]sulfanylmethyl]cyclopropyl]acetic acid |
| SMILES | N#Cc1ccc(-c2ccccc2SCC2(CC(=O)O)CC2)cc1 |
| InChI | InChI=1S/C19H17NO2S/c20-12-14-5-7-15(8-6-14)16-3-1-2-4-17(16)23-13-19(9-10-19)11-18(21)22/h1-8H,9-11,13H2,(H,21,22) |
| InChIKey | IBUWLBTWVXNPTJ-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.42 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |