C13H12N2O4S — CID 65443523
2-[1-[(4-cyano-2-nitrophenyl)sulfanylmethyl]cyclopropyl]acetic acid (PubChem CID 65443523) has the molecular formula C13H12N2O4S and a molecular weight of 292.32 g/mol. Its IUPAC name is 2-[1-[(4-cyano-2-nitrophenyl)sulfanylmethyl]cyclopropyl]acetic acid.
| Compound Name | 2-[1-[(4-cyano-2-nitrophenyl)sulfanylmethyl]cyclopropyl]acetic acid |
|---|---|
| PubChem CID | 65443523 |
| Molecular Formula | C13H12N2O4S |
| Molecular Weight | 292.32 g/mol |
| Exact Mass | 292.05 |
| IUPAC Name | 2-[1-[(4-cyano-2-nitrophenyl)sulfanylmethyl]cyclopropyl]acetic acid |
| SMILES | N#Cc1ccc(SCC2(CC(=O)O)CC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H12N2O4S/c14-7-9-1-2-11(10(5-9)15(18)19)20-8-13(3-4-13)6-12(16)17/h1-2,5H,3-4,6,8H2,(H,16,17) |
| InChIKey | SFNSLBPIHCZFLC-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 104.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.32 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|