C17H12F3N3O5S — CID 2740718
2-(4-cyano-2-nitrophenyl)sulfanylethyl N-[4-(trifluoromethoxy)phenyl]carbamate (PubChem CID 2740718) has the molecular formula C17H12F3N3O5S and a molecular weight of 427.36 g/mol. Its IUPAC name is 2-(4-cyano-2-nitrophenyl)sulfanylethyl N-[4-(trifluoromethoxy)phenyl]carbamate.
| Compound Name | 2-(4-cyano-2-nitrophenyl)sulfanylethyl N-[4-(trifluoromethoxy)phenyl]carbamate |
|---|---|
| PubChem CID | 2740718 |
| Molecular Formula | C17H12F3N3O5S |
| Molecular Weight | 427.36 g/mol |
| Exact Mass | 427.04 |
| IUPAC Name | 2-(4-cyano-2-nitrophenyl)sulfanylethyl N-[4-(trifluoromethoxy)phenyl]carbamate |
| SMILES | N#Cc1ccc(SCCOC(=O)Nc2ccc(OC(F)(F)F)cc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H12F3N3O5S/c18-17(19,20)28-13-4-2-12(3-5-13)22-16(24)27-7-8-29-15-6-1-11(10-21)9-14(15)23(25)26/h1-6,9H,7-8H2,(H,22,24) |
| InChIKey | DJJKPVUMXHHTEB-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 114.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.36 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|