About 2-(4-cyano-2-nitrophenyl)sulfanylethyl 4-chlorobenzoate
2-(4-cyano-2-nitrophenyl)sulfanylethyl 4-chlorobenzoate (PubChem CID 2740699) has the molecular formula C16H11ClN2O4S
and a molecular weight of 362.79 g/mol. Its IUPAC name is 2-(4-cyano-2-nitrophenyl)sulfanylethyl 4-chlorobenzoate.
Molecular Properties
| Compound Name | 2-(4-cyano-2-nitrophenyl)sulfanylethyl 4-chlorobenzoate |
| PubChem CID | 2740699 |
| Molecular Formula | C16H11ClN2O4S |
| Molecular Weight | 362.79 g/mol |
| Exact Mass | 362.01 |
| IUPAC Name | 2-(4-cyano-2-nitrophenyl)sulfanylethyl 4-chlorobenzoate |
| SMILES | N#Cc1ccc(SCCOC(=O)c2ccc(Cl)cc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H11ClN2O4S/c17-13-4-2-12(3-5-13)16(20)23-7-8-24-15-6-1-11(10-18)9-14(15)19(21)22/h1-6,9H,7-8H2 |
| InChIKey | KWMJQEFWZQSADP-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 93.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.79 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(4-cyano-2-nitrophenyl)sulfanylethyl 4-chlorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-cyano-2-nitrophenyl)sulfanylethyl 4-chlorobenzoate?
The IUPAC name of 2-(4-cyano-2-nitrophenyl)sulfanylethyl 4-chlorobenzoate (CID 2740699) is 2-(4-cyano-2-nitrophenyl)sulfanylethyl 4-chlorobenzoate.
What is the SMILES notation for 2-(4-cyano-2-nitrophenyl)sulfanylethyl 4-chlorobenzoate?
The canonical SMILES for 2-(4-cyano-2-nitrophenyl)sulfanylethyl 4-chlorobenzoate is N#Cc1ccc(SCCOC(=O)c2ccc(Cl)cc2)c([N+](=O)[O-])c1.
What is the InChIKey of 2-(4-cyano-2-nitrophenyl)sulfanylethyl 4-chlorobenzoate?
The InChIKey is KWMJQEFWZQSADP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11ClN2O4S/c17-13-4-2-12(3-5-13)16(20)23-7-8-24-15-6-1-11(10-18)9-14(15)19(21)22/h1-6,9H,7-8H2.
What are the key properties of 2-(4-cyano-2-nitrophenyl)sulfanylethyl 4-chlorobenzoate?
2-(4-cyano-2-nitrophenyl)sulfanylethyl 4-chlorobenzoate has a molecular weight of 362.79 g/mol, XLogP of 4.07, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-cyano-2-nitrophenyl)sulfanylethyl 4-chlorobenzoate is sourced from PubChem (CID 2740699), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).