C15H14ClF3N4O2 — CID 118903240
N-[4-(azetidin-3-yloxy)phenyl]-4-(1-chloro-2,2,2-trifluoroethyl)-1H-pyrazole-5-carboxamide (PubChem CID 118903240) has the molecular formula C15H14ClF3N4O2 and a molecular weight of 374.75 g/mol. Its IUPAC name is N-[4-(azetidin-3-yloxy)phenyl]-4-(1-chloro-2,2,2-trifluoroethyl)-1H-pyrazole-5-carboxamide.
| Compound Name | N-[4-(azetidin-3-yloxy)phenyl]-4-(1-chloro-2,2,2-trifluoroethyl)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 118903240 |
| Molecular Formula | C15H14ClF3N4O2 |
| Molecular Weight | 374.75 g/mol |
| Exact Mass | 374.08 |
| IUPAC Name | N-[4-(azetidin-3-yloxy)phenyl]-4-(1-chloro-2,2,2-trifluoroethyl)-1H-pyrazole-5-carboxamide |
| SMILES | O=C(Nc1ccc(OC2CNC2)cc1)c1[nH]ncc1C(Cl)C(F)(F)F |
| InChI | InChI=1S/C15H14ClF3N4O2/c16-13(15(17,18)19)11-7-21-23-12(11)14(24)22-8-1-3-9(4-2-8)25-10-5-20-6-10/h1-4,7,10,13,20H,5-6H2,(H,21,23)(H,22,24) |
| InChIKey | DYEWIKDHXXKFEV-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.75 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|