C12H11F3N2O4 — CID 156785712
[[4-(azetidin-3-yloxy)benzoyl]amino] 2,2,2-trifluoroacetate (PubChem CID 156785712) has the molecular formula C12H11F3N2O4 and a molecular weight of 304.22 g/mol. Its IUPAC name is [[4-(azetidin-3-yloxy)benzoyl]amino] 2,2,2-trifluoroacetate.
| Compound Name | [[4-(azetidin-3-yloxy)benzoyl]amino] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 156785712 |
| Molecular Formula | C12H11F3N2O4 |
| Molecular Weight | 304.22 g/mol |
| Exact Mass | 304.07 |
| IUPAC Name | [[4-(azetidin-3-yloxy)benzoyl]amino] 2,2,2-trifluoroacetate |
| SMILES | O=C(NOC(=O)C(F)(F)F)c1ccc(OC2CNC2)cc1 |
| InChI | InChI=1S/C12H11F3N2O4/c13-12(14,15)11(19)21-17-10(18)7-1-3-8(4-2-7)20-9-5-16-6-9/h1-4,9,16H,5-6H2,(H,17,18) |
| InChIKey | XPJCCDIXMIIWQH-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.22 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|