C15H14ClN3O3S — CID 118906031
1-acetyl-5-chloro-N-pyridin-2-yl-2,3-dihydroindole-6-sulfonamide (PubChem CID 118906031) has the molecular formula C15H14ClN3O3S and a molecular weight of 351.82 g/mol. Its IUPAC name is 1-acetyl-5-chloro-N-pyridin-2-yl-2,3-dihydroindole-6-sulfonamide.
| Compound Name | 1-acetyl-5-chloro-N-pyridin-2-yl-2,3-dihydroindole-6-sulfonamide |
|---|---|
| PubChem CID | 118906031 |
| Molecular Formula | C15H14ClN3O3S |
| Molecular Weight | 351.82 g/mol |
| Exact Mass | 351.04 |
| IUPAC Name | 1-acetyl-5-chloro-N-pyridin-2-yl-2,3-dihydroindole-6-sulfonamide |
| SMILES | CC(=O)N1CCc2cc(Cl)c(S(=O)(=O)Nc3ccccn3)cc21 |
| InChI | InChI=1S/C15H14ClN3O3S/c1-10(20)19-7-5-11-8-12(16)14(9-13(11)19)23(21,22)18-15-4-2-3-6-17-15/h2-4,6,8-9H,5,7H2,1H3,(H,17,18) |
| InChIKey | DXTGRUXPYWAMTF-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.82 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |