C19H34N2O8 — CID 118907319
N-[3-[2,3-bis(2-methoxyethoxy)propoxy]propyl]-3-(2,5-dioxopyrrolidin-1-yl)propanamide (PubChem CID 118907319) has the molecular formula C19H34N2O8 and a molecular weight of 418.49 g/mol. Its IUPAC name is N-[3-[2,3-bis(2-methoxyethoxy)propoxy]propyl]-3-(2,5-dioxopyrrolidin-1-yl)propanamide.
| Compound Name | N-[3-[2,3-bis(2-methoxyethoxy)propoxy]propyl]-3-(2,5-dioxopyrrolidin-1-yl)propanamide |
|---|---|
| PubChem CID | 118907319 |
| Molecular Formula | C19H34N2O8 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.23 |
| IUPAC Name | N-[3-[2,3-bis(2-methoxyethoxy)propoxy]propyl]-3-(2,5-dioxopyrrolidin-1-yl)propanamide |
| SMILES | COCCOCC(COCCCNC(=O)CCN1C(=O)CCC1=O)OCCOC |
| InChI | InChI=1S/C19H34N2O8/c1-25-10-12-28-15-16(29-13-11-26-2)14-27-9-3-7-20-17(22)6-8-21-18(23)4-5-19(21)24/h16H,3-15H2,1-2H3,(H,20,22) |
| InChIKey | GHRVQAQDHUCSPW-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 112.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|