C42H79NO22 — CID 139525550
2,3-bis[2-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propyl 2,5-dioxopyrrolidine-1-carboxylate (PubChem CID 139525550) has the molecular formula C42H79NO22 and a molecular weight of 950.08 g/mol. Its IUPAC name is 2,3-bis[2-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propyl 2,5-dioxopyrrolidine-1-carboxylate.
| Compound Name | 2,3-bis[2-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propyl 2,5-dioxopyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 139525550 |
| Molecular Formula | C42H79NO22 |
| Molecular Weight | 950.08 g/mol |
| Exact Mass | 949.51 |
| IUPAC Name | 2,3-bis[2-[2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propyl 2,5-dioxopyrrolidine-1-carboxylate |
| SMILES | COCCOCCOCCOCCOCCOCCOCCOCCOCC(COC(=O)N1C(=O)CCC1=O)OCCOCCOCCOCCOCCOCCOCCOCCOC |
| InChI | InChI=1S/C42H79NO22/c1-47-5-7-49-9-11-51-13-15-53-17-19-55-21-22-57-25-26-59-29-30-61-33-34-63-37-39(38-65-42(46)43-40(44)3-4-41(43)45)64-36-35-62-32-31-60-28-27-58-24-23-56-20-18-54-16-14-52-12-10-50-8-6-48-2/h39H,3-38H2,1-2H3 |
| InChIKey | OQDRLKXIHLQDCE-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 229.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 22 |
| Rotatable Bonds | 53 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 950.08 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 22 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|