C23H24F3NO4 — CID 118910630
2-[14-methoxy-5-[[(2,2,2-trifluoroacetyl)amino]methyl]-9-tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaenyl]butanoic acid (PubChem CID 118910630) has the molecular formula C23H24F3NO4 and a molecular weight of 435.44 g/mol. Its IUPAC name is 2-[14-methoxy-5-[[(2,2,2-trifluoroacetyl)amino]methyl]-9-tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaenyl]butanoic acid.
| Compound Name | 2-[14-methoxy-5-[[(2,2,2-trifluoroacetyl)amino]methyl]-9-tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaenyl]butanoic acid |
|---|---|
| PubChem CID | 118910630 |
| Molecular Formula | C23H24F3NO4 |
| Molecular Weight | 435.44 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | 2-[14-methoxy-5-[[(2,2,2-trifluoroacetyl)amino]methyl]-9-tricyclo[9.4.0.03,8]pentadeca-1(11),3(8),4,6,12,14-hexaenyl]butanoic acid |
| SMILES | CCC(C(=O)O)C1Cc2ccc(OC)cc2Cc2cc(CNC(=O)C(F)(F)F)ccc21 |
| InChI | InChI=1S/C23H24F3NO4/c1-3-18(21(28)29)20-11-14-5-6-17(31-2)10-15(14)9-16-8-13(4-7-19(16)20)12-27-22(30)23(24,25)26/h4-8,10,18,20H,3,9,11-12H2,1-2H3,(H,27,30)(H,28,29) |
| InChIKey | BWWJLORMUFYRCW-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.44 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |