C23H27ClIN3O2 — CID 118914152
[4-[(5-chloro-1H-indole-2-carbonyl)amino]phenyl]methyl-dimethyl-(oxolan-2-ylmethyl)azanium iodide (PubChem CID 118914152) has the molecular formula C23H27ClIN3O2 and a molecular weight of 539.85 g/mol. Its IUPAC name is [4-[(5-chloro-1H-indole-2-carbonyl)amino]phenyl]methyl-dimethyl-(oxolan-2-ylmethyl)azanium iodide.
| Compound Name | [4-[(5-chloro-1H-indole-2-carbonyl)amino]phenyl]methyl-dimethyl-(oxolan-2-ylmethyl)azanium iodide |
|---|---|
| PubChem CID | 118914152 |
| Molecular Formula | C23H27ClIN3O2 |
| Molecular Weight | 539.85 g/mol |
| Exact Mass | 539.08 |
| IUPAC Name | [4-[(5-chloro-1H-indole-2-carbonyl)amino]phenyl]methyl-dimethyl-(oxolan-2-ylmethyl)azanium iodide |
| SMILES | C[N+](C)(Cc1ccc(NC(=O)c2cc3cc(Cl)ccc3[nH]2)cc1)CC1CCCO1.[I-] |
| InChI | InChI=1S/C23H26ClN3O2.HI/c1-27(2,15-20-4-3-11-29-20)14-16-5-8-19(9-6-16)25-23(28)22-13-17-12-18(24)7-10-21(17)26-22;/h5-10,12-13,20H,3-4,11,14-15H2,1-2H3,(H-,25,26,28);1H |
| InChIKey | IOBCFYPKSAJWFO-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 54.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.85 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|