C21H22ClN3O2 — CID 55977270
5-chloro-N-[4-(2-morpholin-4-ylethyl)phenyl]-1H-indole-2-carboxamide (PubChem CID 55977270) has the molecular formula C21H22ClN3O2 and a molecular weight of 383.88 g/mol. Its IUPAC name is 5-chloro-N-[4-(2-morpholin-4-ylethyl)phenyl]-1H-indole-2-carboxamide.
| Compound Name | 5-chloro-N-[4-(2-morpholin-4-ylethyl)phenyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 55977270 |
| Molecular Formula | C21H22ClN3O2 |
| Molecular Weight | 383.88 g/mol |
| Exact Mass | 383.14 |
| IUPAC Name | 5-chloro-N-[4-(2-morpholin-4-ylethyl)phenyl]-1H-indole-2-carboxamide |
| SMILES | O=C(Nc1ccc(CCN2CCOCC2)cc1)c1cc2cc(Cl)ccc2[nH]1 |
| InChI | InChI=1S/C21H22ClN3O2/c22-17-3-6-19-16(13-17)14-20(24-19)21(26)23-18-4-1-15(2-5-18)7-8-25-9-11-27-12-10-25/h1-6,13-14,24H,7-12H2,(H,23,26) |
| InChIKey | QRZHZPCEZYUHCZ-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.88 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |