C22H24N2O5S3 — CID 11891429
[(3R,4S)-4-benzamidothiolan-3-yl] [(3S,4R)-4-benzamidothiolan-3-yl] sulfite (PubChem CID 11891429) has the molecular formula C22H24N2O5S3 and a molecular weight of 492.64 g/mol. Its IUPAC name is [(3R,4S)-4-benzamidothiolan-3-yl] [(3S,4R)-4-benzamidothiolan-3-yl] sulfite.
| Compound Name | [(3R,4S)-4-benzamidothiolan-3-yl] [(3S,4R)-4-benzamidothiolan-3-yl] sulfite |
|---|---|
| PubChem CID | 11891429 |
| Molecular Formula | C22H24N2O5S3 |
| Molecular Weight | 492.64 g/mol |
| Exact Mass | 492.08 |
| IUPAC Name | [(3R,4S)-4-benzamidothiolan-3-yl] [(3S,4R)-4-benzamidothiolan-3-yl] sulfite |
| SMILES | O=C(N[C@H]1CSC[C@H]1OS(=O)O[C@H]1CSC[C@H]1NC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H24N2O5S3/c25-21(15-7-3-1-4-8-15)23-17-11-30-13-19(17)28-32(27)29-20-14-31-12-18(20)24-22(26)16-9-5-2-6-10-16/h1-10,17-20H,11-14H2,(H,23,25)(H,24,26)/t17-,18+,19+,20-,32? |
| InChIKey | YXQMKFHJAJJFKR-RLAAVVQRSA-N |
| XLogP | 2.43 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.64 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |